Mobile/Wechat/WhatsApp: 13666361637
Email:peterkiter@hotmail.com
CasNo: 5576-42-1
Molecular Formula: C89H133 N25 O22 S
Appearance: WHITE POWDER
General Description |
ACTH (1-16), also known as Adrenocorticotropic hormone, is a peptide hormone produced and secreted by the anterior pituitary gland. It consists of 16 amino acids and is a fragment of the full-length ACTH, which is a 39-amino acid peptide. ACTH (1-16) is crucial in regulating levels of the steroid hormone cortisol, which is released from the adrenal gland. It stimulates the adrenal cortex to produce and release glucocorticoids and plays a significant role in the body's stress response. Abnormal levels of ACTH could be associated with various health problems like Cushing's disease and Addison's disease. |
InChI:InChI=1/C89H133N25O22S/c1-50(2)74(86(133)100-46-71(118)102-59(21-9-12-33-90)77(124)107-64(88(135)136)23-11-14-35-92)113-85(132)70-25-16-37-114(70)87(134)63(22-10-13-34-91)103-72(119)45-99-76(123)67(41-53-43-98-58-20-8-7-19-56(53)58)110-78(125)60(24-15-36-97-89(94)95)104-81(128)66(39-51-17-5-4-6-18-51)109-83(130)68(42-54-44-96-49-101-54)111-79(126)61(30-31-73(120)121)105-80(127)62(32-38-137-3)106-84(131)69(48-116)112-82(129)65(108-75(122)57(93)47-115)40-52-26-28-55(117)29-27-52/h4-8,17-20,26-29,43-44,49-50,57,59-70,74,98,115-117H,9-16,21-25,30-42,45-48,90-93H2,1-3H3,(H,96,101)(H,99,123)(H,100,133)(H,102,118)(H,103,119)(H,104,128)(H,105,127)(H,106,131)(H,107,124)(H,108,122)(H,109,130)(H,110,125)(H,111,126)(H,112,129)(H,113,132)(H,120,121)(H,135,136)(H4,94,95,97)/t57-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,74-/m0/s1