
Mobile/Wechat/WhatsApp: 13666361637
Email:peterkiter@hotmail.com
CasNo: 12794-10-4
Molecular Formula: C9H8 N2
|
General Description |
Benzodiazepines are a class of psychoactive drugs known for their sedative and calming effects. They work by enhancing the activity of gamma-aminobutyric acid (GABA), a neurotransmitter that inhibits the activity of the central nervous system. This results in a decrease in anxiety, muscle tension, and seizures. Benzodiazepines are commonly used to treat anxiety disorders, insomnia, and certain seizure disorders. However, they are also known for their potential to cause dependence and tolerance, and their long-term use is associated with withdrawal symptoms and cognitive impairment. They are typically prescribed for short-term use and should be carefully monitored by a healthcare professional. Some common benzodiazepines include diazepam (Valium), alprazolam (Xanax), and lorazepam (Ativan). |
InChI:InChI=1/C9H8N2/c1-2-6-9-8(4-1)5-3-7-10-11-9/h1-7,11H